| Melting point | 64.43 °C |
| storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility | Soluble in water giving a highly viscous solution, practically insoluble in organic solvents. |
| form | Solid |
| color | Off-White to Pale Yellow |
| Odor | sl. organic odor, tasteless |
| biological source | Xanthomonas campestris |
| Merck | 14,10057 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C8H12N2O2.2ClH/c9-6-1-2-8(7(10)5-6)12-4-3-11;;/h1-2,5,11H,3-4,9-10H2;2*1H |
| InChIKey | VXYWXJXCQSDNHX-UHFFFAOYSA-N |
| SMILES | C(O)COC1=CC=C(N)C=C1N.[H]Cl.[H]Cl |
| LogP | 3.926 (est) |
| CAS DataBase Reference | 11138-66-2(CAS DataBase Reference) |
| EPA Substance Registry System | Xanthan gum (11138-66-2) |